C27H27ClN4OS — CID 178037101
N-[3-[5-chloro-2-[2-(1H-indol-3-yl)ethylcarbamothioylamino]phenyl]propyl]benzamide (PubChem CID 178037101) has the molecular formula C27H27ClN4OS and a molecular weight of 491.06 g/mol. Its IUPAC name is N-[3-[5-chloro-2-[2-(1H-indol-3-yl)ethylcarbamothioylamino]phenyl]propyl]benzamide.
| Compound Name | N-[3-[5-chloro-2-[2-(1H-indol-3-yl)ethylcarbamothioylamino]phenyl]propyl]benzamide |
|---|---|
| PubChem CID | 178037101 |
| Molecular Formula | C27H27ClN4OS |
| Molecular Weight | 491.06 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | N-[3-[5-chloro-2-[2-(1H-indol-3-yl)ethylcarbamothioylamino]phenyl]propyl]benzamide |
| SMILES | O=C(NCCCc1cc(Cl)ccc1NC(=S)NCCc1c[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C27H27ClN4OS/c28-22-12-13-24(20(17-22)9-6-15-29-26(33)19-7-2-1-3-8-19)32-27(34)30-16-14-21-18-31-25-11-5-4-10-23(21)25/h1-5,7-8,10-13,17-18,31H,6,9,14-16H2,(H,29,33)(H2,30,32,34) |
| InChIKey | WUMCDNJMBDDFNJ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.06 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|