C24H30N4OS — CID 178037112
N-butyl-2-[2-[2-(1H-indol-3-yl)ethylcarbamothioylamino]-5-methylphenyl]acetamide (PubChem CID 178037112) has the molecular formula C24H30N4OS and a molecular weight of 422.60 g/mol. Its IUPAC name is N-butyl-2-[2-[2-(1H-indol-3-yl)ethylcarbamothioylamino]-5-methylphenyl]acetamide.
| Compound Name | N-butyl-2-[2-[2-(1H-indol-3-yl)ethylcarbamothioylamino]-5-methylphenyl]acetamide |
|---|---|
| PubChem CID | 178037112 |
| Molecular Formula | C24H30N4OS |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | N-butyl-2-[2-[2-(1H-indol-3-yl)ethylcarbamothioylamino]-5-methylphenyl]acetamide |
| SMILES | CCCCNC(=O)Cc1cc(C)ccc1NC(=S)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H30N4OS/c1-3-4-12-25-23(29)15-19-14-17(2)9-10-21(19)28-24(30)26-13-11-18-16-27-22-8-6-5-7-20(18)22/h5-10,14,16,27H,3-4,11-13,15H2,1-2H3,(H,25,29)(H2,26,28,30) |
| InChIKey | ZLORPYPIGJOWQG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|