C18H18N2O2 — CID 18360710
N-[3-(5-hydroxy-1H-indol-3-yl)propyl]benzamide (PubChem CID 18360710) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-[3-(5-hydroxy-1H-indol-3-yl)propyl]benzamide.
| Compound Name | N-[3-(5-hydroxy-1H-indol-3-yl)propyl]benzamide |
|---|---|
| PubChem CID | 18360710 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-[3-(5-hydroxy-1H-indol-3-yl)propyl]benzamide |
| SMILES | O=C(NCCCc1c[nH]c2ccc(O)cc12)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O2/c21-15-8-9-17-16(11-15)14(12-20-17)7-4-10-19-18(22)13-5-2-1-3-6-13/h1-3,5-6,8-9,11-12,20-21H,4,7,10H2,(H,19,22) |
| InChIKey | XQSDLYOJEYYSFN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|