C19H18N2O4 — CID 118723540
[2-[2-(5-hydroxy-1H-indol-3-yl)ethylcarbamoyl]phenyl] acetate (PubChem CID 118723540) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is [2-[2-(5-hydroxy-1H-indol-3-yl)ethylcarbamoyl]phenyl] acetate.
| Compound Name | [2-[2-(5-hydroxy-1H-indol-3-yl)ethylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 118723540 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | [2-[2-(5-hydroxy-1H-indol-3-yl)ethylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)NCCc1c[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C19H18N2O4/c1-12(22)25-18-5-3-2-4-15(18)19(24)20-9-8-13-11-21-17-7-6-14(23)10-16(13)17/h2-7,10-11,21,23H,8-9H2,1H3,(H,20,24) |
| InChIKey | JAZROSZBYQESRL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|