C28H29Cl2N3O2 — CID 23544291
N-[4-(3,5-dichlorophenyl)butyl]-2-[[2-(5-hydroxy-1H-indol-3-yl)ethylamino]methyl]benzamide (PubChem CID 23544291) has the molecular formula C28H29Cl2N3O2 and a molecular weight of 510.47 g/mol. Its IUPAC name is N-[4-(3,5-dichlorophenyl)butyl]-2-[[2-(5-hydroxy-1H-indol-3-yl)ethylamino]methyl]benzamide.
| Compound Name | N-[4-(3,5-dichlorophenyl)butyl]-2-[[2-(5-hydroxy-1H-indol-3-yl)ethylamino]methyl]benzamide |
|---|---|
| PubChem CID | 23544291 |
| Molecular Formula | C28H29Cl2N3O2 |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | N-[4-(3,5-dichlorophenyl)butyl]-2-[[2-(5-hydroxy-1H-indol-3-yl)ethylamino]methyl]benzamide |
| SMILES | O=C(NCCCCc1cc(Cl)cc(Cl)c1)c1ccccc1CNCCc1c[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C28H29Cl2N3O2/c29-22-13-19(14-23(30)15-22)5-3-4-11-32-28(35)25-7-2-1-6-20(25)17-31-12-10-21-18-33-27-9-8-24(34)16-26(21)27/h1-2,6-9,13-16,18,31,33-34H,3-5,10-12,17H2,(H,32,35) |
| InChIKey | CFFBLSZVIMREDP-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|