C29H33N3O2 — CID 23544156
2-[[2-(6-hydroxy-1H-indol-3-yl)ethylamino]methyl]-N-[4-(4-methylphenyl)butyl]benzamide (PubChem CID 23544156) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is 2-[[2-(6-hydroxy-1H-indol-3-yl)ethylamino]methyl]-N-[4-(4-methylphenyl)butyl]benzamide.
| Compound Name | 2-[[2-(6-hydroxy-1H-indol-3-yl)ethylamino]methyl]-N-[4-(4-methylphenyl)butyl]benzamide |
|---|---|
| PubChem CID | 23544156 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | 2-[[2-(6-hydroxy-1H-indol-3-yl)ethylamino]methyl]-N-[4-(4-methylphenyl)butyl]benzamide |
| SMILES | Cc1ccc(CCCCNC(=O)c2ccccc2CNCCc2c[nH]c3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C29H33N3O2/c1-21-9-11-22(12-10-21)6-4-5-16-31-29(34)27-8-3-2-7-23(27)19-30-17-15-24-20-32-28-18-25(33)13-14-26(24)28/h2-3,7-14,18,20,30,32-33H,4-6,15-17,19H2,1H3,(H,31,34) |
| InChIKey | VNJFEEJOLLUKAE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|