C28H33N3O2 — CID 23544107
2-[[2-(4-acetamidophenyl)ethylamino]methyl]-N-(4-phenylbutyl)benzamide (PubChem CID 23544107) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 2-[[2-(4-acetamidophenyl)ethylamino]methyl]-N-(4-phenylbutyl)benzamide.
| Compound Name | 2-[[2-(4-acetamidophenyl)ethylamino]methyl]-N-(4-phenylbutyl)benzamide |
|---|---|
| PubChem CID | 23544107 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 2-[[2-(4-acetamidophenyl)ethylamino]methyl]-N-(4-phenylbutyl)benzamide |
| SMILES | CC(=O)Nc1ccc(CCNCc2ccccc2C(=O)NCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H33N3O2/c1-22(32)31-26-16-14-24(15-17-26)18-20-29-21-25-12-5-6-13-27(25)28(33)30-19-8-7-11-23-9-3-2-4-10-23/h2-6,9-10,12-17,29H,7-8,11,18-21H2,1H3,(H,30,33)(H,31,32) |
| InChIKey | AMBSNKJONFNPBV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|