C29H31N3O2 — CID 23544256
2-[(8-hydroxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]-N-(4-phenylbutyl)benzamide (PubChem CID 23544256) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 2-[(8-hydroxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]-N-(4-phenylbutyl)benzamide.
| Compound Name | 2-[(8-hydroxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]-N-(4-phenylbutyl)benzamide |
|---|---|
| PubChem CID | 23544256 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 2-[(8-hydroxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]-N-(4-phenylbutyl)benzamide |
| SMILES | O=C(NCCCCc1ccccc1)c1ccccc1CN1CCc2[nH]c3ccc(O)cc3c2C1 |
| InChI | InChI=1S/C29H31N3O2/c33-23-13-14-27-25(18-23)26-20-32(17-15-28(26)31-27)19-22-11-4-5-12-24(22)29(34)30-16-7-6-10-21-8-2-1-3-9-21/h1-5,8-9,11-14,18,31,33H,6-7,10,15-17,19-20H2,(H,30,34) |
| InChIKey | YRLTUHHIGVQHCT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|