C27H29ClN2O2 — CID 23544301
N-[4-(3-chlorophenyl)butyl]-2-[(6-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzamide (PubChem CID 23544301) has the molecular formula C27H29ClN2O2 and a molecular weight of 448.99 g/mol. Its IUPAC name is N-[4-(3-chlorophenyl)butyl]-2-[(6-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzamide.
| Compound Name | N-[4-(3-chlorophenyl)butyl]-2-[(6-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 23544301 |
| Molecular Formula | C27H29ClN2O2 |
| Molecular Weight | 448.99 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | N-[4-(3-chlorophenyl)butyl]-2-[(6-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]benzamide |
| SMILES | O=C(NCCCCc1cccc(Cl)c1)c1ccccc1CN1CCc2cc(O)ccc2C1 |
| InChI | InChI=1S/C27H29ClN2O2/c28-24-9-5-7-20(16-24)6-3-4-14-29-27(32)26-10-2-1-8-23(26)19-30-15-13-21-17-25(31)12-11-22(21)18-30/h1-2,5,7-12,16-17,31H,3-4,6,13-15,18-19H2,(H,29,32) |
| InChIKey | VSMASMSSMQFDIB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.99 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|