C29H34N2O2 — CID 23544196
2-[(7-hydroxy-1,6-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N-(4-phenylbutyl)benzamide (PubChem CID 23544196) has the molecular formula C29H34N2O2 and a molecular weight of 442.60 g/mol. Its IUPAC name is 2-[(7-hydroxy-1,6-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N-(4-phenylbutyl)benzamide.
| Compound Name | 2-[(7-hydroxy-1,6-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N-(4-phenylbutyl)benzamide |
|---|---|
| PubChem CID | 23544196 |
| Molecular Formula | C29H34N2O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 2-[(7-hydroxy-1,6-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-N-(4-phenylbutyl)benzamide |
| SMILES | Cc1cc2c(cc1O)C(C)N(Cc1ccccc1C(=O)NCCCCc1ccccc1)CC2 |
| InChI | InChI=1S/C29H34N2O2/c1-21-18-24-15-17-31(22(2)27(24)19-28(21)32)20-25-13-6-7-14-26(25)29(33)30-16-9-8-12-23-10-4-3-5-11-23/h3-7,10-11,13-14,18-19,22,32H,8-9,12,15-17,20H2,1-2H3,(H,30,33) |
| InChIKey | WMBWLTHKXILTLQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|