C31H33Cl2N3O4 — CID 18768622
2-[1-[(2,4-dichlorophenyl)methyl]-2-oxo-3-[[2-(4-phenylbutylcarbamoyl)phenyl]methyl]-1,3-diazinan-5-yl]acetic acid (PubChem CID 18768622) has the molecular formula C31H33Cl2N3O4 and a molecular weight of 582.53 g/mol. Its IUPAC name is 2-[1-[(2,4-dichlorophenyl)methyl]-2-oxo-3-[[2-(4-phenylbutylcarbamoyl)phenyl]methyl]-1,3-diazinan-5-yl]acetic acid.
| Compound Name | 2-[1-[(2,4-dichlorophenyl)methyl]-2-oxo-3-[[2-(4-phenylbutylcarbamoyl)phenyl]methyl]-1,3-diazinan-5-yl]acetic acid |
|---|---|
| PubChem CID | 18768622 |
| Molecular Formula | C31H33Cl2N3O4 |
| Molecular Weight | 582.53 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | 2-[1-[(2,4-dichlorophenyl)methyl]-2-oxo-3-[[2-(4-phenylbutylcarbamoyl)phenyl]methyl]-1,3-diazinan-5-yl]acetic acid |
| SMILES | O=C(O)CC1CN(Cc2ccc(Cl)cc2Cl)C(=O)N(Cc2ccccc2C(=O)NCCCCc2ccccc2)C1 |
| InChI | InChI=1S/C31H33Cl2N3O4/c32-26-14-13-25(28(33)17-26)21-36-19-23(16-29(37)38)18-35(31(36)40)20-24-11-4-5-12-27(24)30(39)34-15-7-6-10-22-8-2-1-3-9-22/h1-5,8-9,11-14,17,23H,6-7,10,15-16,18-21H2,(H,34,39)(H,37,38) |
| InChIKey | CZNVCSZNBBAXQL-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.53 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|