C26H32BrN3O4 — CID 20601209
2-[1-(4-bromophenyl)-3-[[2-(hexylcarbamoyl)phenyl]methyl]-2-oxo-1,3-diazinan-5-yl]acetic acid (PubChem CID 20601209) has the molecular formula C26H32BrN3O4 and a molecular weight of 530.46 g/mol. Its IUPAC name is 2-[1-(4-bromophenyl)-3-[[2-(hexylcarbamoyl)phenyl]methyl]-2-oxo-1,3-diazinan-5-yl]acetic acid.
| Compound Name | 2-[1-(4-bromophenyl)-3-[[2-(hexylcarbamoyl)phenyl]methyl]-2-oxo-1,3-diazinan-5-yl]acetic acid |
|---|---|
| PubChem CID | 20601209 |
| Molecular Formula | C26H32BrN3O4 |
| Molecular Weight | 530.46 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | 2-[1-(4-bromophenyl)-3-[[2-(hexylcarbamoyl)phenyl]methyl]-2-oxo-1,3-diazinan-5-yl]acetic acid |
| SMILES | CCCCCCNC(=O)c1ccccc1CN1CC(CC(=O)O)CN(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C26H32BrN3O4/c1-2-3-4-7-14-28-25(33)23-9-6-5-8-20(23)18-29-16-19(15-24(31)32)17-30(26(29)34)22-12-10-21(27)11-13-22/h5-6,8-13,19H,2-4,7,14-18H2,1H3,(H,28,33)(H,31,32) |
| InChIKey | IQSNCVHLYZKISX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|