C26H31BrN4O3 — CID 142078686
2-[[3-(4-bromophenyl)-2-oxo-5-(2-oxoethyl)-1,3-diazinan-1-yl]methyl]-N-(2-pyrrolidin-1-ylethyl)benzamide (PubChem CID 142078686) has the molecular formula C26H31BrN4O3 and a molecular weight of 527.46 g/mol. Its IUPAC name is 2-[[3-(4-bromophenyl)-2-oxo-5-(2-oxoethyl)-1,3-diazinan-1-yl]methyl]-N-(2-pyrrolidin-1-ylethyl)benzamide.
| Compound Name | 2-[[3-(4-bromophenyl)-2-oxo-5-(2-oxoethyl)-1,3-diazinan-1-yl]methyl]-N-(2-pyrrolidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 142078686 |
| Molecular Formula | C26H31BrN4O3 |
| Molecular Weight | 527.46 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 2-[[3-(4-bromophenyl)-2-oxo-5-(2-oxoethyl)-1,3-diazinan-1-yl]methyl]-N-(2-pyrrolidin-1-ylethyl)benzamide |
| SMILES | O=CCC1CN(Cc2ccccc2C(=O)NCCN2CCCC2)C(=O)N(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C26H31BrN4O3/c27-22-7-9-23(10-8-22)31-18-20(11-16-32)17-30(26(31)34)19-21-5-1-2-6-24(21)25(33)28-12-15-29-13-3-4-14-29/h1-2,5-10,16,20H,3-4,11-15,17-19H2,(H,28,33) |
| InChIKey | MESIUCNHBSZYJX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|