C17H14BrClN2O2 — CID 155518400
N-[2-(5-bromo-1H-indol-3-yl)ethyl]-5-chloro-2-hydroxybenzamide (PubChem CID 155518400) has the molecular formula C17H14BrClN2O2 and a molecular weight of 393.67 g/mol. Its IUPAC name is N-[2-(5-bromo-1H-indol-3-yl)ethyl]-5-chloro-2-hydroxybenzamide.
| Compound Name | N-[2-(5-bromo-1H-indol-3-yl)ethyl]-5-chloro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 155518400 |
| Molecular Formula | C17H14BrClN2O2 |
| Molecular Weight | 393.67 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | N-[2-(5-bromo-1H-indol-3-yl)ethyl]-5-chloro-2-hydroxybenzamide |
| SMILES | O=C(NCCc1c[nH]c2ccc(Br)cc12)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C17H14BrClN2O2/c18-11-1-3-15-13(7-11)10(9-21-15)5-6-20-17(23)14-8-12(19)2-4-16(14)22/h1-4,7-9,21-22H,5-6H2,(H,20,23) |
| InChIKey | PLKQVWNVUYJEFZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.67 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |