C17H13BrCl2N2O — CID 155563944
N-[2-(5-bromo-1H-indol-3-yl)ethyl]-3,4-dichlorobenzamide (PubChem CID 155563944) has the molecular formula C17H13BrCl2N2O and a molecular weight of 412.11 g/mol. Its IUPAC name is N-[2-(5-bromo-1H-indol-3-yl)ethyl]-3,4-dichlorobenzamide.
| Compound Name | N-[2-(5-bromo-1H-indol-3-yl)ethyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 155563944 |
| Molecular Formula | C17H13BrCl2N2O |
| Molecular Weight | 412.11 g/mol |
| Exact Mass | 409.96 |
| IUPAC Name | N-[2-(5-bromo-1H-indol-3-yl)ethyl]-3,4-dichlorobenzamide |
| SMILES | O=C(NCCc1c[nH]c2ccc(Br)cc12)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H13BrCl2N2O/c18-12-2-4-16-13(8-12)11(9-22-16)5-6-21-17(23)10-1-3-14(19)15(20)7-10/h1-4,7-9,22H,5-6H2,(H,21,23) |
| InChIKey | KFYBWABVUYGOQK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.11 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |