C17H18Cl2N2S — CID 17299089
1-(2-butylphenyl)-3-(2,5-dichlorophenyl)thiourea (PubChem CID 17299089) has the molecular formula C17H18Cl2N2S and a molecular weight of 353.32 g/mol. Its IUPAC name is 1-(2-butylphenyl)-3-(2,5-dichlorophenyl)thiourea.
| Compound Name | 1-(2-butylphenyl)-3-(2,5-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 17299089 |
| Molecular Formula | C17H18Cl2N2S |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 1-(2-butylphenyl)-3-(2,5-dichlorophenyl)thiourea |
| SMILES | CCCCc1ccccc1NC(=S)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H18Cl2N2S/c1-2-3-6-12-7-4-5-8-15(12)20-17(22)21-16-11-13(18)9-10-14(16)19/h4-5,7-11H,2-3,6H2,1H3,(H2,20,21,22) |
| InChIKey | RODFNZLIYYLZOM-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|