About (2-butylphenyl)carbamodithioic acid;tungsten
(2-butylphenyl)carbamodithioic acid;tungsten (PubChem CID 174689067) has the molecular formula C11H15NS2W
and a molecular weight of 409.22 g/mol. Its IUPAC name is (2-butylphenyl)carbamodithioic acid;tungsten.
Molecular Properties
| Compound Name | (2-butylphenyl)carbamodithioic acid;tungsten |
| PubChem CID | 174689067 |
| Molecular Formula | C11H15NS2W |
| Molecular Weight | 409.22 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | (2-butylphenyl)carbamodithioic acid;tungsten |
| SMILES | CCCCc1ccccc1NC(=S)S.[W] |
| InChI | InChI=1S/C11H15NS2.W/c1-2-3-6-9-7-4-5-8-10(9)12-11(13)14;/h4-5,7-8H,2-3,6H2,1H3,(H2,12,13,14); |
| InChIKey | UGNDEEREMJVPIA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2-butylphenyl)carbamodithioic acid;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-butylphenyl)carbamodithioic acid;tungsten?
The IUPAC name of (2-butylphenyl)carbamodithioic acid;tungsten (CID 174689067) is (2-butylphenyl)carbamodithioic acid;tungsten.
What is the SMILES notation for (2-butylphenyl)carbamodithioic acid;tungsten?
The canonical SMILES for (2-butylphenyl)carbamodithioic acid;tungsten is CCCCc1ccccc1NC(=S)S.[W].
What is the InChIKey of (2-butylphenyl)carbamodithioic acid;tungsten?
The InChIKey is UGNDEEREMJVPIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NS2.W/c1-2-3-6-9-7-4-5-8-10(9)12-11(13)14;/h4-5,7-8H,2-3,6H2,1H3,(H2,12,13,14);.
What are the key properties of (2-butylphenyl)carbamodithioic acid;tungsten?
(2-butylphenyl)carbamodithioic acid;tungsten has a molecular weight of 409.22 g/mol, XLogP of 3.65, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-butylphenyl)carbamodithioic acid;tungsten is sourced from PubChem (CID 174689067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).