About (2-nonylphenyl)carbamodithioic acid;hydrate
(2-nonylphenyl)carbamodithioic acid;hydrate (PubChem CID 172688080) has the molecular formula C16H27NOS2
and a molecular weight of 313.53 g/mol. Its IUPAC name is (2-nonylphenyl)carbamodithioic acid;hydrate.
Molecular Properties
| Compound Name | (2-nonylphenyl)carbamodithioic acid;hydrate |
| PubChem CID | 172688080 |
| Molecular Formula | C16H27NOS2 |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (2-nonylphenyl)carbamodithioic acid;hydrate |
| SMILES | CCCCCCCCCc1ccccc1NC(=S)S.O |
| InChI | InChI=1S/C16H25NS2.H2O/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)17-16(18)19;/h9-10,12-13H,2-8,11H2,1H3,(H2,17,18,19);1H2 |
| InChIKey | UZIJDPZPZDWICF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 43.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2-nonylphenyl)carbamodithioic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nonylphenyl)carbamodithioic acid;hydrate?
The IUPAC name of (2-nonylphenyl)carbamodithioic acid;hydrate (CID 172688080) is (2-nonylphenyl)carbamodithioic acid;hydrate.
What is the SMILES notation for (2-nonylphenyl)carbamodithioic acid;hydrate?
The canonical SMILES for (2-nonylphenyl)carbamodithioic acid;hydrate is CCCCCCCCCc1ccccc1NC(=S)S.O.
What is the InChIKey of (2-nonylphenyl)carbamodithioic acid;hydrate?
The InChIKey is UZIJDPZPZDWICF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NS2.H2O/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)17-16(18)19;/h9-10,12-13H,2-8,11H2,1H3,(H2,17,18,19);1H2.
What are the key properties of (2-nonylphenyl)carbamodithioic acid;hydrate?
(2-nonylphenyl)carbamodithioic acid;hydrate has a molecular weight of 313.53 g/mol, XLogP of 4.78, 9 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nonylphenyl)carbamodithioic acid;hydrate is sourced from PubChem (CID 172688080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).