C17H19ArN3OS — CID 170549225
argon;N-[(4-butyl-2-pyridinyl)carbamothioyl]benzamide (PubChem CID 170549225) has the molecular formula C17H19ArN3OS and a molecular weight of 353.37 g/mol. Its IUPAC name is argon;N-[(4-butyl-2-pyridinyl)carbamothioyl]benzamide.
| Compound Name | argon;N-[(4-butyl-2-pyridinyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 170549225 |
| Molecular Formula | C17H19ArN3OS |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | argon;N-[(4-butyl-2-pyridinyl)carbamothioyl]benzamide |
| SMILES | CCCCc1ccnc(NC(=S)NC(=O)c2ccccc2)c1.[Ar] |
| InChI | InChI=1S/C17H19N3OS.Ar/c1-2-3-7-13-10-11-18-15(12-13)19-17(22)20-16(21)14-8-5-4-6-9-14;/h4-6,8-12H,2-3,7H2,1H3,(H2,18,19,20,21,22); |
| InChIKey | BVBMEIWOFJGRLS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|