C14H12ClN3OS — CID 881307
3-chloro-N-[(4-methyl-2-pyridinyl)carbamothioyl]benzamide (PubChem CID 881307) has the molecular formula C14H12ClN3OS and a molecular weight of 305.79 g/mol. Its IUPAC name is 3-chloro-N-[(4-methyl-2-pyridinyl)carbamothioyl]benzamide.
| Compound Name | 3-chloro-N-[(4-methyl-2-pyridinyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 881307 |
| Molecular Formula | C14H12ClN3OS |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 3-chloro-N-[(4-methyl-2-pyridinyl)carbamothioyl]benzamide |
| SMILES | Cc1ccnc(NC(=S)NC(=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C14H12ClN3OS/c1-9-5-6-16-12(7-9)17-14(20)18-13(19)10-3-2-4-11(15)8-10/h2-8H,1H3,(H2,16,17,18,19,20) |
| InChIKey | RQOTZJAAJJMRII-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|