C10H9ClN6OS — CID 931371
3-chloro-N-[(2-methyltetrazol-5-yl)carbamothioyl]benzamide (PubChem CID 931371) has the molecular formula C10H9ClN6OS and a molecular weight of 296.74 g/mol. Its IUPAC name is 3-chloro-N-[(2-methyltetrazol-5-yl)carbamothioyl]benzamide.
| Compound Name | 3-chloro-N-[(2-methyltetrazol-5-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 931371 |
| Molecular Formula | C10H9ClN6OS |
| Molecular Weight | 296.74 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 3-chloro-N-[(2-methyltetrazol-5-yl)carbamothioyl]benzamide |
| SMILES | Cn1nnc(NC(=S)NC(=O)c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C10H9ClN6OS/c1-17-15-9(14-16-17)13-10(19)12-8(18)6-3-2-4-7(11)5-6/h2-5H,1H3,(H2,12,13,15,18,19) |
| InChIKey | GJFKOUHKANYPQA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.74 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|