C11H10Cl2N6O2S — CID 2024113
3,5-dichloro-2-methoxy-N-[(2-methyltetrazol-5-yl)carbamothioyl]benzamide (PubChem CID 2024113) has the molecular formula C11H10Cl2N6O2S and a molecular weight of 361.21 g/mol. Its IUPAC name is 3,5-dichloro-2-methoxy-N-[(2-methyltetrazol-5-yl)carbamothioyl]benzamide.
| Compound Name | 3,5-dichloro-2-methoxy-N-[(2-methyltetrazol-5-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 2024113 |
| Molecular Formula | C11H10Cl2N6O2S |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 3,5-dichloro-2-methoxy-N-[(2-methyltetrazol-5-yl)carbamothioyl]benzamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C(=O)NC(=S)Nc1nnn(C)n1 |
| InChI | InChI=1S/C11H10Cl2N6O2S/c1-19-17-10(16-18-19)15-11(22)14-9(20)6-3-5(12)4-7(13)8(6)21-2/h3-4H,1-2H3,(H2,14,15,17,20,22) |
| InChIKey | SUVWAZDBUOXSNA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|