C7H12N6OS — CID 5200751
N-[(2-methyltetrazol-5-yl)carbamothioyl]butanamide (PubChem CID 5200751) has the molecular formula C7H12N6OS and a molecular weight of 228.28 g/mol. Its IUPAC name is N-[(2-methyltetrazol-5-yl)carbamothioyl]butanamide.
| Compound Name | N-[(2-methyltetrazol-5-yl)carbamothioyl]butanamide |
|---|---|
| PubChem CID | 5200751 |
| Molecular Formula | C7H12N6OS |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | N-[(2-methyltetrazol-5-yl)carbamothioyl]butanamide |
| SMILES | CCCC(=O)NC(=S)Nc1nnn(C)n1 |
| InChI | InChI=1S/C7H12N6OS/c1-3-4-5(14)8-7(15)9-6-10-12-13(2)11-6/h3-4H2,1-2H3,(H2,8,9,11,14,15) |
| InChIKey | UBDGYSIJLJIZAK-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|