C12H14N6O3S — CID 931341
3,5-dimethoxy-N-[(2-methyltetrazol-5-yl)carbamothioyl]benzamide (PubChem CID 931341) has the molecular formula C12H14N6O3S and a molecular weight of 322.35 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[(2-methyltetrazol-5-yl)carbamothioyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[(2-methyltetrazol-5-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 931341 |
| Molecular Formula | C12H14N6O3S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 3,5-dimethoxy-N-[(2-methyltetrazol-5-yl)carbamothioyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)NC(=S)Nc2nnn(C)n2)c1 |
| InChI | InChI=1S/C12H14N6O3S/c1-18-16-11(15-17-18)14-12(22)13-10(19)7-4-8(20-2)6-9(5-7)21-3/h4-6H,1-3H3,(H2,13,14,16,19,22) |
| InChIKey | YBMIYGRIZMSEDI-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|