C31H48NP — CID 102325221
N-[2,6-di(propan-2-yl)phenyl]-1-(2,4,6-tritert-butylphenyl)phosphanylmethanimine (PubChem CID 102325221) has the molecular formula C31H48NP and a molecular weight of 465.71 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-1-(2,4,6-tritert-butylphenyl)phosphanylmethanimine.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-1-(2,4,6-tritert-butylphenyl)phosphanylmethanimine |
|---|---|
| PubChem CID | 102325221 |
| Molecular Formula | C31H48NP |
| Molecular Weight | 465.71 g/mol |
| Exact Mass | 465.35 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-1-(2,4,6-tritert-butylphenyl)phosphanylmethanimine |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C/Pc1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C31H48NP/c1-20(2)23-15-14-16-24(21(3)4)27(23)32-19-33-28-25(30(8,9)10)17-22(29(5,6)7)18-26(28)31(11,12)13/h14-21,33H,1-13H3/b32-19+ |
| InChIKey | KPWBRYMOSKCEEG-BIZUNTBRSA-N |
| XLogP | 9.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.71 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|