C26H37LiN2O — CID 59993633
lithium 2,4-ditert-butyl-6-[[2,6-di(propan-2-yl)phenyl]diazenyl]phenolate (PubChem CID 59993633) has the molecular formula C26H37LiN2O and a molecular weight of 400.54 g/mol. Its IUPAC name is lithium 2,4-ditert-butyl-6-[[2,6-di(propan-2-yl)phenyl]diazenyl]phenolate.
| Compound Name | lithium 2,4-ditert-butyl-6-[[2,6-di(propan-2-yl)phenyl]diazenyl]phenolate |
|---|---|
| PubChem CID | 59993633 |
| Molecular Formula | C26H37LiN2O |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.31 |
| IUPAC Name | lithium 2,4-ditert-butyl-6-[[2,6-di(propan-2-yl)phenyl]diazenyl]phenolate |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=N/c1cc(C(C)(C)C)cc(C(C)(C)C)c1[O-].[Li+] |
| InChI | InChI=1S/C26H38N2O.Li/c1-16(2)19-12-11-13-20(17(3)4)23(19)28-27-22-15-18(25(5,6)7)14-21(24(22)29)26(8,9)10;/h11-17,29H,1-10H3;/q;+1/p-1/b28-27+; |
| InChIKey | QZVKKVBUZSRFKZ-RXQWRGDBSA-M |
| XLogP | 5.02 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|