C30H44N2O — CID 139199827
2,4-ditert-butyl-6-[3-[2,6-di(propan-2-yl)phenyl]iminobutan-2-ylideneamino]phenol (PubChem CID 139199827) has the molecular formula C30H44N2O and a molecular weight of 448.70 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[3-[2,6-di(propan-2-yl)phenyl]iminobutan-2-ylideneamino]phenol.
| Compound Name | 2,4-ditert-butyl-6-[3-[2,6-di(propan-2-yl)phenyl]iminobutan-2-ylideneamino]phenol |
|---|---|
| PubChem CID | 139199827 |
| Molecular Formula | C30H44N2O |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 448.35 |
| IUPAC Name | 2,4-ditert-butyl-6-[3-[2,6-di(propan-2-yl)phenyl]iminobutan-2-ylideneamino]phenol |
| SMILES | CC(=N\c1cc(C(C)(C)C)cc(C(C)(C)C)c1O)/C(C)=N/c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C30H44N2O/c1-18(2)23-14-13-15-24(19(3)4)27(23)32-21(6)20(5)31-26-17-22(29(7,8)9)16-25(28(26)33)30(10,11)12/h13-19,33H,1-12H3/b31-20+,32-21+ |
| InChIKey | XSNSOLDKWNASNJ-XIBHFCPISA-N |
| XLogP | 9.12 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|