C27H39N2Ni- — CID 21339154
N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diimine;carbanide;nickel (PubChem CID 21339154) has the molecular formula C27H39N2Ni- and a molecular weight of 450.32 g/mol. Its IUPAC name is N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diimine;carbanide;nickel.
| Compound Name | N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diimine;carbanide;nickel |
|---|---|
| PubChem CID | 21339154 |
| Molecular Formula | C27H39N2Ni- |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diimine;carbanide;nickel |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C/C=N/c1c(C(C)C)cccc1C(C)C.[CH3-].[Ni] |
| InChI | InChI=1S/C26H36N2.CH3.Ni/c1-17(2)21-11-9-12-22(18(3)4)25(21)27-15-16-28-26-23(19(5)6)13-10-14-24(26)20(7)8;;/h9-20H,1-8H3;1H3;/q;-1;/b27-15+,28-16+;; |
| InChIKey | GOLDVUNSPJYBPP-HQRQQUDRSA-N |
| XLogP | 8.73 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|