C19H23N2Ni- — CID 59881388
N,N'-bis(2,6-dimethylphenyl)ethane-1,2-diimine;carbanide;nickel (PubChem CID 59881388) has the molecular formula C19H23N2Ni- and a molecular weight of 338.10 g/mol. Its IUPAC name is N,N'-bis(2,6-dimethylphenyl)ethane-1,2-diimine;carbanide;nickel.
| Compound Name | N,N'-bis(2,6-dimethylphenyl)ethane-1,2-diimine;carbanide;nickel |
|---|---|
| PubChem CID | 59881388 |
| Molecular Formula | C19H23N2Ni- |
| Molecular Weight | 338.10 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N,N'-bis(2,6-dimethylphenyl)ethane-1,2-diimine;carbanide;nickel |
| SMILES | Cc1cccc(C)c1/N=C/C=N/c1c(C)cccc1C.[CH3-].[Ni] |
| InChI | InChI=1S/C18H20N2.CH3.Ni/c1-13-7-5-8-14(2)17(13)19-11-12-20-18-15(3)9-6-10-16(18)4;;/h5-12H,1-4H3;1H3;/q;-1;/b19-11+,20-12+;; |
| InChIKey | HYRPCMSIDOPJHL-GAMUHHASSA-N |
| XLogP | 5.47 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.10 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|