About N'-(2,6-ditert-butylphenyl)-N-(2-methylphenyl)ethane-1,2-diimine
N'-(2,6-ditert-butylphenyl)-N-(2-methylphenyl)ethane-1,2-diimine (PubChem CID 150901095) has the molecular formula C23H30N2
and a molecular weight of 334.51 g/mol. Its IUPAC name is N'-(2,6-ditert-butylphenyl)-N-(2-methylphenyl)ethane-1,2-diimine.
Molecular Properties
| Compound Name | N'-(2,6-ditert-butylphenyl)-N-(2-methylphenyl)ethane-1,2-diimine |
| PubChem CID | 150901095 |
| Molecular Formula | C23H30N2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | N'-(2,6-ditert-butylphenyl)-N-(2-methylphenyl)ethane-1,2-diimine |
| SMILES | Cc1ccccc1/N=C/C=N/c1c(C(C)(C)C)cccc1C(C)(C)C |
| InChI | InChI=1S/C23H30N2/c1-17-11-8-9-14-20(17)24-15-16-25-21-18(22(2,3)4)12-10-13-19(21)23(5,6)7/h8-16H,1-7H3/b24-15+,25-16+ |
| InChIKey | LAACZHMLJPXTDG-FEZYOMQXSA-N |
| XLogP | 6.69 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,6-ditert-butylphenyl)-N-(2-methylphenyl)ethane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,6-ditert-butylphenyl)-N-(2-methylphenyl)ethane-1,2-diimine?
The IUPAC name of N'-(2,6-ditert-butylphenyl)-N-(2-methylphenyl)ethane-1,2-diimine (CID 150901095) is N'-(2,6-ditert-butylphenyl)-N-(2-methylphenyl)ethane-1,2-diimine.
What is the SMILES notation for N'-(2,6-ditert-butylphenyl)-N-(2-methylphenyl)ethane-1,2-diimine?
The canonical SMILES for N'-(2,6-ditert-butylphenyl)-N-(2-methylphenyl)ethane-1,2-diimine is Cc1ccccc1/N=C/C=N/c1c(C(C)(C)C)cccc1C(C)(C)C.
What is the InChIKey of N'-(2,6-ditert-butylphenyl)-N-(2-methylphenyl)ethane-1,2-diimine?
The InChIKey is LAACZHMLJPXTDG-FEZYOMQXSA-N. The full InChI is InChI=1S/C23H30N2/c1-17-11-8-9-14-20(17)24-15-16-25-21-18(22(2,3)4)12-10-13-19(21)23(5,6)7/h8-16H,1-7H3/b24-15+,25-16+.
What are the key properties of N'-(2,6-ditert-butylphenyl)-N-(2-methylphenyl)ethane-1,2-diimine?
N'-(2,6-ditert-butylphenyl)-N-(2-methylphenyl)ethane-1,2-diimine has a molecular weight of 334.51 g/mol, XLogP of 6.69, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,6-ditert-butylphenyl)-N-(2-methylphenyl)ethane-1,2-diimine is sourced from PubChem (CID 150901095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).