C22H37N — CID 42636627
N-(2,6-ditert-butylphenyl)octan-1-imine (PubChem CID 42636627) has the molecular formula C22H37N and a molecular weight of 315.55 g/mol. Its IUPAC name is N-(2,6-ditert-butylphenyl)octan-1-imine.
| Compound Name | N-(2,6-ditert-butylphenyl)octan-1-imine |
|---|---|
| PubChem CID | 42636627 |
| Molecular Formula | C22H37N |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | N-(2,6-ditert-butylphenyl)octan-1-imine |
| SMILES | CCCCCCC/C=N/c1c(C(C)(C)C)cccc1C(C)(C)C |
| InChI | InChI=1S/C22H37N/c1-8-9-10-11-12-13-17-23-20-18(21(2,3)4)15-14-16-19(20)22(5,6)7/h14-17H,8-13H2,1-7H3/b23-17+ |
| InChIKey | LQEOYRDSEXRVLB-HAVVHWLPSA-N |
| XLogP | 7.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|