C12H12F5N — CID 11242538
N-(2,3,4,5,6-pentafluorophenyl)hexan-1-imine (PubChem CID 11242538) has the molecular formula C12H12F5N and a molecular weight of 265.22 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentafluorophenyl)hexan-1-imine.
| Compound Name | N-(2,3,4,5,6-pentafluorophenyl)hexan-1-imine |
|---|---|
| PubChem CID | 11242538 |
| Molecular Formula | C12H12F5N |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | N-(2,3,4,5,6-pentafluorophenyl)hexan-1-imine |
| SMILES | CCCCC/C=N/c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H12F5N/c1-2-3-4-5-6-18-12-10(16)8(14)7(13)9(15)11(12)17/h6H,2-5H2,1H3/b18-6+ |
| InChIKey | NCWOADVXBUQXNU-NGYBGAFCSA-N |
| XLogP | 4.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|