C12H15N — CID 142169551
acetylene;N-(2,6-dimethylphenyl)ethanimine (PubChem CID 142169551) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is acetylene;N-(2,6-dimethylphenyl)ethanimine.
| Compound Name | acetylene;N-(2,6-dimethylphenyl)ethanimine |
|---|---|
| PubChem CID | 142169551 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | acetylene;N-(2,6-dimethylphenyl)ethanimine |
| SMILES | C#C.C/C=N/c1c(C)cccc1C |
| InChI | InChI=1S/C10H13N.C2H2/c1-4-11-10-8(2)6-5-7-9(10)3;1-2/h4-7H,1-3H3;1-2H/b11-4+; |
| InChIKey | XIICUZYUQMUXLA-SODSUQDMSA-N |
| XLogP | 3.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|