C8H9NTi+2 — CID 11384908
(2,6-dimethylphenyl)iminotitanium(2+) (PubChem CID 11384908) has the molecular formula C8H9NTi+2 and a molecular weight of 167.03 g/mol. Its IUPAC name is (2,6-dimethylphenyl)iminotitanium(2+).
| Compound Name | (2,6-dimethylphenyl)iminotitanium(2+) |
|---|---|
| PubChem CID | 11384908 |
| Molecular Formula | C8H9NTi+2 |
| Molecular Weight | 167.03 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | (2,6-dimethylphenyl)iminotitanium(2+) |
| SMILES | Cc1cccc(C)c1N=[Ti+2] |
| InChI | InChI=1S/C8H9N.Ti/c1-6-4-3-5-7(2)8(6)9;/h3-5H,1-2H3;/q;+2 |
| InChIKey | RKBYVMIZALRVLO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.03 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |