C30H26F2N2 — CID 140654196
N,N'-bis(2,6-dimethylphenyl)-1,2-bis(4-fluorophenyl)ethane-1,2-diimine (PubChem CID 140654196) has the molecular formula C30H26F2N2 and a molecular weight of 452.55 g/mol. Its IUPAC name is N,N'-bis(2,6-dimethylphenyl)-1,2-bis(4-fluorophenyl)ethane-1,2-diimine.
| Compound Name | N,N'-bis(2,6-dimethylphenyl)-1,2-bis(4-fluorophenyl)ethane-1,2-diimine |
|---|---|
| PubChem CID | 140654196 |
| Molecular Formula | C30H26F2N2 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | N,N'-bis(2,6-dimethylphenyl)-1,2-bis(4-fluorophenyl)ethane-1,2-diimine |
| SMILES | Cc1cccc(C)c1/N=C(C(=N/c1c(C)cccc1C)/c1ccc(F)cc1)\c1ccc(F)cc1 |
| InChI | InChI=1S/C30H26F2N2/c1-19-7-5-8-20(2)27(19)33-29(23-11-15-25(31)16-12-23)30(24-13-17-26(32)18-14-24)34-28-21(3)9-6-10-22(28)4/h5-18H,1-4H3/b33-29+,34-30+ |
| InChIKey | BECJXWCSMVIJLC-BNRZXNFUSA-N |
| XLogP | 8.14 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|