C14H10F2N2O2 — CID 177490589
(NE)-N-[(2E)-1,2-bis(4-fluorophenyl)-2-hydroxyiminoethylidene]hydroxylamine (PubChem CID 177490589) has the molecular formula C14H10F2N2O2 and a molecular weight of 276.24 g/mol. Its IUPAC name is (NE)-N-[(2E)-1,2-bis(4-fluorophenyl)-2-hydroxyiminoethylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2E)-1,2-bis(4-fluorophenyl)-2-hydroxyiminoethylidene]hydroxylamine |
|---|---|
| PubChem CID | 177490589 |
| Molecular Formula | C14H10F2N2O2 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | (NE)-N-[(2E)-1,2-bis(4-fluorophenyl)-2-hydroxyiminoethylidene]hydroxylamine |
| SMILES | O/N=C(C(=N/O)/c1ccc(F)cc1)\c1ccc(F)cc1 |
| InChI | InChI=1S/C14H10F2N2O2/c15-11-5-1-9(2-6-11)13(17-19)14(18-20)10-3-7-12(16)8-4-10/h1-8,19-20H/b17-13+,18-14+ |
| InChIKey | ZEGJFCPQDKMWNT-HBKJEHTGSA-N |
| XLogP | 3.02 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|