C15H11F2NO — CID 177390235
(NE)-N-[3,3-bis(4-fluorophenyl)prop-2-enylidene]hydroxylamine (PubChem CID 177390235) has the molecular formula C15H11F2NO and a molecular weight of 259.25 g/mol. Its IUPAC name is (NE)-N-[3,3-bis(4-fluorophenyl)prop-2-enylidene]hydroxylamine.
| Compound Name | (NE)-N-[3,3-bis(4-fluorophenyl)prop-2-enylidene]hydroxylamine |
|---|---|
| PubChem CID | 177390235 |
| Molecular Formula | C15H11F2NO |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (NE)-N-[3,3-bis(4-fluorophenyl)prop-2-enylidene]hydroxylamine |
| SMILES | O/N=C/C=C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H11F2NO/c16-13-5-1-11(2-6-13)15(9-10-18-19)12-3-7-14(17)8-4-12/h1-10,19H/b18-10+ |
| InChIKey | XOEWSAVNJVWCEG-VCHYOVAHSA-N |
| XLogP | 3.86 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|