C14H8Br2F2 — CID 139674428
1-[1,2-dibromo-2-(4-fluorophenyl)ethenyl]-4-fluorobenzene (PubChem CID 139674428) has the molecular formula C14H8Br2F2 and a molecular weight of 374.02 g/mol. Its IUPAC name is 1-[1,2-dibromo-2-(4-fluorophenyl)ethenyl]-4-fluorobenzene.
| Compound Name | 1-[1,2-dibromo-2-(4-fluorophenyl)ethenyl]-4-fluorobenzene |
|---|---|
| PubChem CID | 139674428 |
| Molecular Formula | C14H8Br2F2 |
| Molecular Weight | 374.02 g/mol |
| Exact Mass | 371.90 |
| IUPAC Name | 1-[1,2-dibromo-2-(4-fluorophenyl)ethenyl]-4-fluorobenzene |
| SMILES | Fc1ccc(C(Br)=C(Br)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C14H8Br2F2/c15-13(9-1-5-11(17)6-2-9)14(16)10-3-7-12(18)8-4-10/h1-8H |
| InChIKey | LKBXFVXUOJIXMW-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.02 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|