C19H22ClF2N — CID 110168456
4,4-bis(4-fluorophenyl)but-3-enyl-propan-2-ylazanium chloride (PubChem CID 110168456) has the molecular formula C19H22ClF2N and a molecular weight of 337.84 g/mol. Its IUPAC name is 4,4-bis(4-fluorophenyl)but-3-enyl-propan-2-ylazanium chloride.
| Compound Name | 4,4-bis(4-fluorophenyl)but-3-enyl-propan-2-ylazanium chloride |
|---|---|
| PubChem CID | 110168456 |
| Molecular Formula | C19H22ClF2N |
| Molecular Weight | 337.84 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 4,4-bis(4-fluorophenyl)but-3-enyl-propan-2-ylazanium chloride |
| SMILES | CC(C)[NH2+]CCC=C(c1ccc(F)cc1)c1ccc(F)cc1.[Cl-] |
| InChI | InChI=1S/C19H21F2N.ClH/c1-14(2)22-13-3-4-19(15-5-9-17(20)10-6-15)16-7-11-18(21)12-8-16;/h4-12,14,22H,3,13H2,1-2H3;1H |
| InChIKey | OULCSECQVGMKJW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.84 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|