C38H42F2N2 — CID 20647689
N,N'-bis[2,6-di(propan-2-yl)phenyl]-1,2-bis(4-fluorophenyl)ethane-1,2-diimine (PubChem CID 20647689) has the molecular formula C38H42F2N2 and a molecular weight of 564.76 g/mol. Its IUPAC name is N,N'-bis[2,6-di(propan-2-yl)phenyl]-1,2-bis(4-fluorophenyl)ethane-1,2-diimine.
| Compound Name | N,N'-bis[2,6-di(propan-2-yl)phenyl]-1,2-bis(4-fluorophenyl)ethane-1,2-diimine |
|---|---|
| PubChem CID | 20647689 |
| Molecular Formula | C38H42F2N2 |
| Molecular Weight | 564.76 g/mol |
| Exact Mass | 564.33 |
| IUPAC Name | N,N'-bis[2,6-di(propan-2-yl)phenyl]-1,2-bis(4-fluorophenyl)ethane-1,2-diimine |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C(C(=N\c1c(C(C)C)cccc1C(C)C)\c1ccc(F)cc1)/c1ccc(F)cc1 |
| InChI | InChI=1S/C38H42F2N2/c1-23(2)31-11-9-12-32(24(3)4)37(31)41-35(27-15-19-29(39)20-16-27)36(28-17-21-30(40)22-18-28)42-38-33(25(5)6)13-10-14-34(38)26(7)8/h9-26H,1-8H3/b41-35-,42-36+ |
| InChIKey | AIEPWFQPFHGQDM-FOXLNIFNSA-N |
| XLogP | 11.40 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.76 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|