C12H17NTi+2 — CID 11564443
[2,6-di(propan-2-yl)phenyl]iminotitanium(2+) (PubChem CID 11564443) has the molecular formula C12H17NTi+2 and a molecular weight of 223.14 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl]iminotitanium(2+).
| Compound Name | [2,6-di(propan-2-yl)phenyl]iminotitanium(2+) |
|---|---|
| PubChem CID | 11564443 |
| Molecular Formula | C12H17NTi+2 |
| Molecular Weight | 223.14 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl]iminotitanium(2+) |
| SMILES | CC(C)c1cccc(C(C)C)c1N=[Ti+2] |
| InChI | InChI=1S/C12H17N.Ti/c1-8(2)10-6-5-7-11(9(3)4)12(10)13;/h5-9H,1-4H3;/q;+2 |
| InChIKey | RRPWAKPBQIGNQI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.14 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |