C15H14FNS — CID 58240211
N-(2,6-dimethylphenyl)-4-fluorobenzenecarbothioamide (PubChem CID 58240211) has the molecular formula C15H14FNS and a molecular weight of 259.35 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-fluorobenzenecarbothioamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 58240211 |
| Molecular Formula | C15H14FNS |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-fluorobenzenecarbothioamide |
| SMILES | Cc1cccc(C)c1NC(=S)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H14FNS/c1-10-4-3-5-11(2)14(10)17-15(18)12-6-8-13(16)9-7-12/h3-9H,1-2H3,(H,17,18) |
| InChIKey | DYURZJRWDWYHFP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|