C15H14ClFN2S — CID 53489311
1-(2-chloro-4-fluorophenyl)-3-(2,6-dimethylphenyl)thiourea (PubChem CID 53489311) has the molecular formula C15H14ClFN2S and a molecular weight of 308.81 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)-3-(2,6-dimethylphenyl)thiourea.
| Compound Name | 1-(2-chloro-4-fluorophenyl)-3-(2,6-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 53489311 |
| Molecular Formula | C15H14ClFN2S |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)-3-(2,6-dimethylphenyl)thiourea |
| SMILES | Cc1cccc(C)c1NC(=S)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H14ClFN2S/c1-9-4-3-5-10(2)14(9)19-15(20)18-13-7-6-11(17)8-12(13)16/h3-8H,1-2H3,(H2,18,19,20) |
| InChIKey | DRQPMJJZGHTNRT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|