C33H31Cl2FN4 — CID 138631073
1-[3-[N-(2,4-dichloro-6-methylphenyl)-C-(4-fluorophenyl)carbonimidoyl]-1,3-diazinan-1-yl]-N-(2,6-dimethylphenyl)-1-phenylmethanimine (PubChem CID 138631073) has the molecular formula C33H31Cl2FN4 and a molecular weight of 573.54 g/mol. Its IUPAC name is 1-[3-[N-(2,4-dichloro-6-methylphenyl)-C-(4-fluorophenyl)carbonimidoyl]-1,3-diazinan-1-yl]-N-(2,6-dimethylphenyl)-1-phenylmethanimine.
| Compound Name | 1-[3-[N-(2,4-dichloro-6-methylphenyl)-C-(4-fluorophenyl)carbonimidoyl]-1,3-diazinan-1-yl]-N-(2,6-dimethylphenyl)-1-phenylmethanimine |
|---|---|
| PubChem CID | 138631073 |
| Molecular Formula | C33H31Cl2FN4 |
| Molecular Weight | 573.54 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | 1-[3-[N-(2,4-dichloro-6-methylphenyl)-C-(4-fluorophenyl)carbonimidoyl]-1,3-diazinan-1-yl]-N-(2,6-dimethylphenyl)-1-phenylmethanimine |
| SMILES | Cc1cccc(C)c1/N=C(\c1ccccc1)N1CCCN(/C(=N/c2c(C)cc(Cl)cc2Cl)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C33H31Cl2FN4/c1-22-9-7-10-23(2)30(22)37-32(25-11-5-4-6-12-25)39-17-8-18-40(21-39)33(26-13-15-28(36)16-14-26)38-31-24(3)19-27(34)20-29(31)35/h4-7,9-16,19-20H,8,17-18,21H2,1-3H3/b37-32+,38-33+ |
| InChIKey | RDLHNAMWVRMALZ-VGWJSVSZSA-N |
| XLogP | 8.88 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.54 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|