C34H37FN4O3 — CID 110073772
[6-benzyl-10-(5-ethyl-1,2-oxazole-3-carbonyl)-16-methyl-2,6,10-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]-(4-fluorophenyl)methanone (PubChem CID 110073772) has the molecular formula C34H37FN4O3 and a molecular weight of 568.69 g/mol. Its IUPAC name is [6-benzyl-10-(5-ethyl-1,2-oxazole-3-carbonyl)-16-methyl-2,6,10-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]-(4-fluorophenyl)methanone.
| Compound Name | [6-benzyl-10-(5-ethyl-1,2-oxazole-3-carbonyl)-16-methyl-2,6,10-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 110073772 |
| Molecular Formula | C34H37FN4O3 |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | [6-benzyl-10-(5-ethyl-1,2-oxazole-3-carbonyl)-16-methyl-2,6,10-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]-(4-fluorophenyl)methanone |
| SMILES | CCc1cc(C(=O)N2CCCN(Cc3ccccc3)CCCN(C(=O)c3ccc(F)cc3)c3c(C)cccc3C2)no1 |
| InChI | InChI=1S/C34H37FN4O3/c1-3-30-22-31(36-42-30)34(41)38-20-8-18-37(23-26-11-5-4-6-12-26)19-9-21-39(32-25(2)10-7-13-28(32)24-38)33(40)27-14-16-29(35)17-15-27/h4-7,10-17,22H,3,8-9,18-21,23-24H2,1-2H3 |
| InChIKey | WTAGDUPWXUTBRX-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |