C29H33ClN4O3 — CID 110075787
[6-[(4-chlorophenyl)methyl]-10-(5-methyl-1,2-oxazole-3-carbonyl)-2,6,10-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]-cyclopropylmethanone (PubChem CID 110075787) has the molecular formula C29H33ClN4O3 and a molecular weight of 521.06 g/mol. Its IUPAC name is [6-[(4-chlorophenyl)methyl]-10-(5-methyl-1,2-oxazole-3-carbonyl)-2,6,10-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]-cyclopropylmethanone.
| Compound Name | [6-[(4-chlorophenyl)methyl]-10-(5-methyl-1,2-oxazole-3-carbonyl)-2,6,10-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 110075787 |
| Molecular Formula | C29H33ClN4O3 |
| Molecular Weight | 521.06 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | [6-[(4-chlorophenyl)methyl]-10-(5-methyl-1,2-oxazole-3-carbonyl)-2,6,10-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]-cyclopropylmethanone |
| SMILES | Cc1cc(C(=O)N2CCCN(Cc3ccc(Cl)cc3)CCCN(C(=O)C3CC3)c3ccccc3C2)no1 |
| InChI | InChI=1S/C29H33ClN4O3/c1-21-18-26(31-37-21)29(36)33-16-4-14-32(19-22-8-12-25(30)13-9-22)15-5-17-34(28(35)23-10-11-23)27-7-3-2-6-24(27)20-33/h2-3,6-9,12-13,18,23H,4-5,10-11,14-17,19-20H2,1H3 |
| InChIKey | PLAGQIBCTWJXDS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.06 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |