C28H33ClF3N3O2 — CID 110068190
1-[6-[(4-chlorophenyl)methyl]-2-(cyclopropanecarbonyl)-2,6,10-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-10-yl]-4,4,4-trifluorobutan-1-one (PubChem CID 110068190) has the molecular formula C28H33ClF3N3O2 and a molecular weight of 536.04 g/mol. Its IUPAC name is 1-[6-[(4-chlorophenyl)methyl]-2-(cyclopropanecarbonyl)-2,6,10-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-10-yl]-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-[6-[(4-chlorophenyl)methyl]-2-(cyclopropanecarbonyl)-2,6,10-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-10-yl]-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 110068190 |
| Molecular Formula | C28H33ClF3N3O2 |
| Molecular Weight | 536.04 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | 1-[6-[(4-chlorophenyl)methyl]-2-(cyclopropanecarbonyl)-2,6,10-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-10-yl]-4,4,4-trifluorobutan-1-one |
| SMILES | O=C(CCC(F)(F)F)N1CCCN(Cc2ccc(Cl)cc2)CCCN(C(=O)C2CC2)c2ccccc2C1 |
| InChI | InChI=1S/C28H33ClF3N3O2/c29-24-11-7-21(8-12-24)19-33-15-3-17-34(26(36)13-14-28(30,31)32)20-23-5-1-2-6-25(23)35(18-4-16-33)27(37)22-9-10-22/h1-2,5-8,11-12,22H,3-4,9-10,13-20H2 |
| InChIKey | AGINOBUSIYXXHJ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.04 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |