C17H17FN2O2S — CID 6359531
(NE)-4-fluoro-N-[phenyl(pyrrolidin-1-yl)methylidene]benzenesulfonamide (PubChem CID 6359531) has the molecular formula C17H17FN2O2S and a molecular weight of 332.40 g/mol. Its IUPAC name is (NE)-4-fluoro-N-[phenyl(pyrrolidin-1-yl)methylidene]benzenesulfonamide.
| Compound Name | (NE)-4-fluoro-N-[phenyl(pyrrolidin-1-yl)methylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 6359531 |
| Molecular Formula | C17H17FN2O2S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (NE)-4-fluoro-N-[phenyl(pyrrolidin-1-yl)methylidene]benzenesulfonamide |
| SMILES | O=S(=O)(/N=C(\c1ccccc1)N1CCCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FN2O2S/c18-15-8-10-16(11-9-15)23(21,22)19-17(20-12-4-5-13-20)14-6-2-1-3-7-14/h1-3,6-11H,4-5,12-13H2/b19-17+ |
| InChIKey | MYTWEDIXBYJHDD-HTXNQAPBSA-N |
| XLogP | 3.06 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|