C20H24N2O2S — CID 7721969
N-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]-phenylmethylidene]benzenesulfonamide (PubChem CID 7721969) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is N-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]-phenylmethylidene]benzenesulfonamide.
| Compound Name | N-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]-phenylmethylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 7721969 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | N-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]-phenylmethylidene]benzenesulfonamide |
| SMILES | C[C@@H]1C[C@@H](C)CN(C(=NS(=O)(=O)c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C20H24N2O2S/c1-16-13-17(2)15-22(14-16)20(18-9-5-3-6-10-18)21-25(23,24)19-11-7-4-8-12-19/h3-12,16-17H,13-15H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | NKEGAOUJCUCSFW-IAGOWNOFSA-N |
| XLogP | 3.80 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|