C24H24N2O3S — CID 2336192
N-[3,4-dihydro-1H-isoquinolin-2-yl(phenyl)methylidene]-4-ethoxybenzenesulfonamide (PubChem CID 2336192) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is N-[3,4-dihydro-1H-isoquinolin-2-yl(phenyl)methylidene]-4-ethoxybenzenesulfonamide.
| Compound Name | N-[3,4-dihydro-1H-isoquinolin-2-yl(phenyl)methylidene]-4-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 2336192 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-[3,4-dihydro-1H-isoquinolin-2-yl(phenyl)methylidene]-4-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N=C(c2ccccc2)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C24H24N2O3S/c1-2-29-22-12-14-23(15-13-22)30(27,28)25-24(20-9-4-3-5-10-20)26-17-16-19-8-6-7-11-21(19)18-26/h3-15H,2,16-18H2,1H3 |
| InChIKey | XBVIFTOAJYKGOG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|